C18H16FN3OS — CID 7231876
N-[(Z)-[2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 7231876) has the molecular formula C18H16FN3OS and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[(Z)-[2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-[2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 7231876 |
| Molecular Formula | C18H16FN3OS |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[(Z)-[2-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(N/N=C\c2ccccc2OCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H16FN3OS/c1-13-12-24-18(21-13)22-20-10-15-4-2-3-5-17(15)23-11-14-6-8-16(19)9-7-14/h2-10,12H,11H2,1H3,(H,21,22)/b20-10- |
| InChIKey | IJGBTRGLPBOGFE-JMIUGGIZSA-N |
| XLogP | 4.62 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|