C20H14F3IN4O3 — CID 126123482
N-[(Z)-[3-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126123482) has the molecular formula C20H14F3IN4O3 and a molecular weight of 542.26 g/mol. Its IUPAC name is N-[(Z)-[3-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-[3-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126123482 |
| Molecular Formula | C20H14F3IN4O3 |
| Molecular Weight | 542.26 g/mol |
| Exact Mass | 542.01 |
| IUPAC Name | N-[(Z)-[3-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccc(COc2ccc(/C=N\Nc3ccc(C(F)(F)F)cn3)cc2I)c1 |
| InChI | InChI=1S/C20H14F3IN4O3/c21-20(22,23)15-5-7-19(25-11-15)27-26-10-13-4-6-18(17(24)9-13)31-12-14-2-1-3-16(8-14)28(29)30/h1-11H,12H2,(H,25,27)/b26-10- |
| InChIKey | NOXCYAOLEDQFIE-KALUYTGESA-N |
| XLogP | 5.64 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.26 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|