C20H16F3N3O5 — CID 3482441
5-[[2-methoxy-4-[[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 3482441) has the molecular formula C20H16F3N3O5 and a molecular weight of 435.36 g/mol. Its IUPAC name is 5-[[2-methoxy-4-[[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[2-methoxy-4-[[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 3482441 |
| Molecular Formula | C20H16F3N3O5 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 5-[[2-methoxy-4-[[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COc1cc(C=NNc2ccc(C(F)(F)F)cn2)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C20H16F3N3O5/c1-29-17-8-12(9-25-26-18-7-3-13(10-24-18)20(21,22)23)2-5-15(17)30-11-14-4-6-16(31-14)19(27)28/h2-10H,11H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | CSYDQWAKAVJGPK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|