C21H17NO7 — CID 126390891
5-[[4-[(4-carboxyphenyl)iminomethyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid (PubChem CID 126390891) has the molecular formula C21H17NO7 and a molecular weight of 395.37 g/mol. Its IUPAC name is 5-[[4-[(4-carboxyphenyl)iminomethyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[(4-carboxyphenyl)iminomethyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 126390891 |
| Molecular Formula | C21H17NO7 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 5-[[4-[(4-carboxyphenyl)iminomethyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COc1cc(/C=N/c2ccc(C(=O)O)cc2)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C21H17NO7/c1-27-19-10-13(11-22-15-5-3-14(4-6-15)20(23)24)2-8-17(19)28-12-16-7-9-18(29-16)21(25)26/h2-11H,12H2,1H3,(H,23,24)(H,25,26)/b22-11+ |
| InChIKey | SIDCZKOGPMGGMU-SSDVNMTOSA-N |
| XLogP | 4.01 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|