C20H16FNO5 — CID 126390502
5-[[4-[(3-fluorophenyl)iminomethyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid (PubChem CID 126390502) has the molecular formula C20H16FNO5 and a molecular weight of 369.35 g/mol. Its IUPAC name is 5-[[4-[(3-fluorophenyl)iminomethyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[(3-fluorophenyl)iminomethyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 126390502 |
| Molecular Formula | C20H16FNO5 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 5-[[4-[(3-fluorophenyl)iminomethyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COc1cc(/C=N/c2cccc(F)c2)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C20H16FNO5/c1-25-19-9-13(11-22-15-4-2-3-14(21)10-15)5-7-17(19)26-12-16-6-8-18(27-16)20(23)24/h2-11H,12H2,1H3,(H,23,24)/b22-11+ |
| InChIKey | OSXOUQRALAHJGQ-SSDVNMTOSA-N |
| XLogP | 4.46 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|