C21H19N3O6 — CID 3900269
5-[[2-methoxy-4-[(phenylcarbamoylhydrazinylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 3900269) has the molecular formula C21H19N3O6 and a molecular weight of 409.40 g/mol. Its IUPAC name is 5-[[2-methoxy-4-[(phenylcarbamoylhydrazinylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[2-methoxy-4-[(phenylcarbamoylhydrazinylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 3900269 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 5-[[2-methoxy-4-[(phenylcarbamoylhydrazinylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COc1cc(C=NNC(=O)Nc2ccccc2)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C21H19N3O6/c1-28-19-11-14(12-22-24-21(27)23-15-5-3-2-4-6-15)7-9-17(19)29-13-16-8-10-18(30-16)20(25)26/h2-12H,13H2,1H3,(H,25,26)(H2,23,24,27) |
| InChIKey | HZLYXSMLQBYIKO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|