C21H18BrNO5 — CID 126391051
5-[[4-[(2-bromo-4-methylphenyl)iminomethyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid (PubChem CID 126391051) has the molecular formula C21H18BrNO5 and a molecular weight of 444.28 g/mol. Its IUPAC name is 5-[[4-[(2-bromo-4-methylphenyl)iminomethyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[(2-bromo-4-methylphenyl)iminomethyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 126391051 |
| Molecular Formula | C21H18BrNO5 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 5-[[4-[(2-bromo-4-methylphenyl)iminomethyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COc1cc(/C=N/c2ccc(C)cc2Br)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C21H18BrNO5/c1-13-3-6-17(16(22)9-13)23-11-14-4-7-18(20(10-14)26-2)27-12-15-5-8-19(28-15)21(24)25/h3-11H,12H2,1-2H3,(H,24,25)/b23-11+ |
| InChIKey | UOBGOTYLRFGNKR-FOKLQQMPSA-N |
| XLogP | 5.39 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|