C16H16F3N3O3 — CID 18229276
5-(trifluoromethyl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]pyridin-2-amine (PubChem CID 18229276) has the molecular formula C16H16F3N3O3 and a molecular weight of 355.32 g/mol. Its IUPAC name is 5-(trifluoromethyl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]pyridin-2-amine.
| Compound Name | 5-(trifluoromethyl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 18229276 |
| Molecular Formula | C16H16F3N3O3 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 5-(trifluoromethyl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]pyridin-2-amine |
| SMILES | COc1cc(/C=N/Nc2ccc(C(F)(F)F)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C16H16F3N3O3/c1-23-12-6-10(7-13(24-2)15(12)25-3)8-21-22-14-5-4-11(9-20-14)16(17,18)19/h4-9H,1-3H3,(H,20,22)/b21-8+ |
| InChIKey | JMHAMKGOIZHLCU-ODCIPOBUSA-N |
| XLogP | 3.57 |
| TPSA | 64.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|