C22H16ClF3N4O2 — CID 126108215
2-[[2-chloro-6-methoxy-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126108215) has the molecular formula C22H16ClF3N4O2 and a molecular weight of 460.84 g/mol. Its IUPAC name is 2-[[2-chloro-6-methoxy-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-chloro-6-methoxy-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126108215 |
| Molecular Formula | C22H16ClF3N4O2 |
| Molecular Weight | 460.84 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 2-[[2-chloro-6-methoxy-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=N\Nc2ccc(C(F)(F)F)cn2)cc(Cl)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C22H16ClF3N4O2/c1-31-19-9-14(11-29-30-20-7-6-17(12-28-20)22(24,25)26)8-18(23)21(19)32-13-16-5-3-2-4-15(16)10-27/h2-9,11-12H,13H2,1H3,(H,28,30)/b29-11- |
| InChIKey | XAKFJGWJBKDMSN-KYMQWJLESA-N |
| XLogP | 5.66 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.84 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|