C12H9F3N4 — CID 73428568
N-(pyridin-4-ylmethylideneamino)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 73428568) has the molecular formula C12H9F3N4 and a molecular weight of 266.23 g/mol. Its IUPAC name is N-(pyridin-4-ylmethylideneamino)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(pyridin-4-ylmethylideneamino)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 73428568 |
| Molecular Formula | C12H9F3N4 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-(pyridin-4-ylmethylideneamino)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(NN=Cc2ccncc2)nc1 |
| InChI | InChI=1S/C12H9F3N4/c13-12(14,15)10-1-2-11(17-8-10)19-18-7-9-3-5-16-6-4-9/h1-8H,(H,17,19) |
| InChIKey | GXGNITVQMBFVQR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|