C20H13F3I3N3O — CID 126107094
N-[(Z)-[3,5-diiodo-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126107094) has the molecular formula C20H13F3I3N3O and a molecular weight of 749.05 g/mol. Its IUPAC name is N-[(Z)-[3,5-diiodo-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-[3,5-diiodo-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126107094 |
| Molecular Formula | C20H13F3I3N3O |
| Molecular Weight | 749.05 g/mol |
| Exact Mass | 748.81 |
| IUPAC Name | N-[(Z)-[3,5-diiodo-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(N/N=C\c2cc(I)c(OCc3ccc(I)cc3)c(I)c2)nc1 |
| InChI | InChI=1S/C20H13F3I3N3O/c21-20(22,23)14-3-6-18(27-10-14)29-28-9-13-7-16(25)19(17(26)8-13)30-11-12-1-4-15(24)5-2-12/h1-10H,11H2,(H,27,29)/b28-9- |
| InChIKey | WMEPKRFMVHIFDR-BMWVXGTQSA-N |
| XLogP | 6.94 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.05 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|