C16H13F3IN3O — CID 126112328
N-[(Z)-(3-iodo-4-prop-2-enoxyphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126112328) has the molecular formula C16H13F3IN3O and a molecular weight of 447.20 g/mol. Its IUPAC name is N-[(Z)-(3-iodo-4-prop-2-enoxyphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-(3-iodo-4-prop-2-enoxyphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126112328 |
| Molecular Formula | C16H13F3IN3O |
| Molecular Weight | 447.20 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | N-[(Z)-(3-iodo-4-prop-2-enoxyphenyl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | C=CCOc1ccc(/C=N\Nc2ccc(C(F)(F)F)cn2)cc1I |
| InChI | InChI=1S/C16H13F3IN3O/c1-2-7-24-14-5-3-11(8-13(14)20)9-22-23-15-6-4-12(10-21-15)16(17,18)19/h2-6,8-10H,1,7H2,(H,21,23)/b22-9- |
| InChIKey | LRARIGQOFKOCBK-AFPJDJCSSA-N |
| XLogP | 4.72 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.20 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|