C17H15F3IN3O3 — CID 126114474
ethyl 2-[2-iodo-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126114474) has the molecular formula C17H15F3IN3O3 and a molecular weight of 493.22 g/mol. Its IUPAC name is ethyl 2-[2-iodo-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-iodo-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126114474 |
| Molecular Formula | C17H15F3IN3O3 |
| Molecular Weight | 493.22 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | ethyl 2-[2-iodo-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=N\Nc2ccc(C(F)(F)F)cn2)cc1I |
| InChI | InChI=1S/C17H15F3IN3O3/c1-2-26-16(25)10-27-14-5-3-11(7-13(14)21)8-23-24-15-6-4-12(9-22-15)17(18,19)20/h3-9H,2,10H2,1H3,(H,22,24)/b23-8- |
| InChIKey | VRKVOUISRPIJBX-NYAPKIOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.22 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|