C23H20F3IN4O3 — CID 126112142
2-[2-ethoxy-6-iodo-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]-N-phenylacetamide (PubChem CID 126112142) has the molecular formula C23H20F3IN4O3 and a molecular weight of 584.34 g/mol. Its IUPAC name is 2-[2-ethoxy-6-iodo-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-ethoxy-6-iodo-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126112142 |
| Molecular Formula | C23H20F3IN4O3 |
| Molecular Weight | 584.34 g/mol |
| Exact Mass | 584.05 |
| IUPAC Name | 2-[2-ethoxy-6-iodo-4-[(Z)-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(/C=N\Nc2ccc(C(F)(F)F)cn2)cc(I)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H20F3IN4O3/c1-2-33-19-11-15(12-29-31-20-9-8-16(13-28-20)23(24,25)26)10-18(27)22(19)34-14-21(32)30-17-6-4-3-5-7-17/h3-13H,2,14H2,1H3,(H,28,31)(H,30,32)/b29-12- |
| InChIKey | KTWQPCLDZHDKTK-ULPWCQAASA-N |
| XLogP | 5.57 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.34 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|