C20H14Br2F3N3O — CID 126070396
N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126070396) has the molecular formula C20H14Br2F3N3O and a molecular weight of 529.15 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126070396 |
| Molecular Formula | C20H14Br2F3N3O |
| Molecular Weight | 529.15 g/mol |
| Exact Mass | 526.95 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(N/N=C\c2ccc(OCc3ccc(Br)cc3)c(Br)c2)nc1 |
| InChI | InChI=1S/C20H14Br2F3N3O/c21-16-5-1-13(2-6-16)12-29-18-7-3-14(9-17(18)22)10-27-28-19-8-4-15(11-26-19)20(23,24)25/h1-11H,12H2,(H,26,28)/b27-10- |
| InChIKey | BESZCCQXUFQTFM-NCAUGAEKSA-N |
| XLogP | 6.65 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.15 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|