C24H17BrF3N3O — CID 126110455
N-[(Z)-[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126110455) has the molecular formula C24H17BrF3N3O and a molecular weight of 500.32 g/mol. Its IUPAC name is N-[(Z)-[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126110455 |
| Molecular Formula | C24H17BrF3N3O |
| Molecular Weight | 500.32 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | N-[(Z)-[2-[(4-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(N/N=C\c2c(OCc3ccc(Br)cc3)ccc3ccccc23)nc1 |
| InChI | InChI=1S/C24H17BrF3N3O/c25-19-9-5-16(6-10-19)15-32-22-11-7-17-3-1-2-4-20(17)21(22)14-30-31-23-12-8-18(13-29-23)24(26,27)28/h1-14H,15H2,(H,29,31)/b30-14- |
| InChIKey | DVPDNFKKOMXJAV-CPDSRJINSA-N |
| XLogP | 7.04 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.32 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|