C25H20F3N3O — CID 126104919
N-[(Z)-[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126104919) has the molecular formula C25H20F3N3O and a molecular weight of 435.45 g/mol. Its IUPAC name is N-[(Z)-[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126104919 |
| Molecular Formula | C25H20F3N3O |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[(Z)-[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1ccc(COc2ccc3ccccc3c2/C=N\Nc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C25H20F3N3O/c1-17-6-8-18(9-7-17)16-32-23-12-10-19-4-2-3-5-21(19)22(23)15-30-31-24-13-11-20(14-29-24)25(26,27)28/h2-15H,16H2,1H3,(H,29,31)/b30-15- |
| InChIKey | QSCACOFTNGSSSL-MNDYBZJGSA-N |
| XLogP | 6.59 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|