C23H19F3N4 — CID 126110569
N-[(Z)-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126110569) has the molecular formula C23H19F3N4 and a molecular weight of 408.43 g/mol. Its IUPAC name is N-[(Z)-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126110569 |
| Molecular Formula | C23H19F3N4 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[(Z)-(2,5-dimethyl-1-naphthalen-1-ylpyrrol-3-yl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1cc(/C=N\Nc2ccc(C(F)(F)F)cn2)c(C)n1-c1cccc2ccccc12 |
| InChI | InChI=1S/C23H19F3N4/c1-15-12-18(13-28-29-22-11-10-19(14-27-22)23(24,25)26)16(2)30(15)21-9-5-7-17-6-3-4-8-20(17)21/h3-14H,1-2H3,(H,27,29)/b28-13- |
| InChIKey | GSTGZSHYMKUEPP-QDTIIGTASA-N |
| XLogP | 6.11 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|