C21H19F3N4 — CID 126106857
N-[(Z)-(4-pyrrolidin-1-ylnaphthalen-1-yl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126106857) has the molecular formula C21H19F3N4 and a molecular weight of 384.41 g/mol. Its IUPAC name is N-[(Z)-(4-pyrrolidin-1-ylnaphthalen-1-yl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-(4-pyrrolidin-1-ylnaphthalen-1-yl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126106857 |
| Molecular Formula | C21H19F3N4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[(Z)-(4-pyrrolidin-1-ylnaphthalen-1-yl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(N/N=C\c2ccc(N3CCCC3)c3ccccc23)nc1 |
| InChI | InChI=1S/C21H19F3N4/c22-21(23,24)16-8-10-20(25-14-16)27-26-13-15-7-9-19(28-11-3-4-12-28)18-6-2-1-5-17(15)18/h1-2,5-10,13-14H,3-4,11-12H2,(H,25,27)/b26-13- |
| InChIKey | UBQDJLMYWUMJKC-ZMFRSBBQSA-N |
| XLogP | 5.30 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|