C15H12F3N3O2 — CID 126075676
N-[(Z)-(6-methyl-1,3-benzodioxol-5-yl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126075676) has the molecular formula C15H12F3N3O2 and a molecular weight of 323.27 g/mol. Its IUPAC name is N-[(Z)-(6-methyl-1,3-benzodioxol-5-yl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(Z)-(6-methyl-1,3-benzodioxol-5-yl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126075676 |
| Molecular Formula | C15H12F3N3O2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[(Z)-(6-methyl-1,3-benzodioxol-5-yl)methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1cc2c(cc1/C=N\Nc1ccc(C(F)(F)F)cn1)OCO2 |
| InChI | InChI=1S/C15H12F3N3O2/c1-9-4-12-13(23-8-22-12)5-10(9)6-20-21-14-3-2-11(7-19-14)15(16,17)18/h2-7H,8H2,1H3,(H,19,21)/b20-6- |
| InChIKey | XAQRXHMHXTZXAI-IOXNKQMXSA-N |
| XLogP | 3.58 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|