C15H14F6N4 — CID 2322247
N-[[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 2322247) has the molecular formula C15H14F6N4 and a molecular weight of 364.29 g/mol. Its IUPAC name is N-[[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 2322247 |
| Molecular Formula | C15H14F6N4 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]methylideneamino]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1cc(C=NNc2ccc(C(F)(F)F)cn2)c(C)n1CC(F)(F)F |
| InChI | InChI=1S/C15H14F6N4/c1-9-5-11(10(2)25(9)8-14(16,17)18)6-23-24-13-4-3-12(7-22-13)15(19,20)21/h3-7H,8H2,1-2H3,(H,22,24) |
| InChIKey | TUEWOVYYFZMNOL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|