C16H15F6N3 — CID 6282077
N-[(Z)-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]methylideneamino]-4-(trifluoromethyl)aniline (PubChem CID 6282077) has the molecular formula C16H15F6N3 and a molecular weight of 363.31 g/mol. Its IUPAC name is N-[(Z)-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]methylideneamino]-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]methylideneamino]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 6282077 |
| Molecular Formula | C16H15F6N3 |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[(Z)-[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]methylideneamino]-4-(trifluoromethyl)aniline |
| SMILES | Cc1cc(/C=N\Nc2ccc(C(F)(F)F)cc2)c(C)n1CC(F)(F)F |
| InChI | InChI=1S/C16H15F6N3/c1-10-7-12(11(2)25(10)9-15(17,18)19)8-23-24-14-5-3-13(4-6-14)16(20,21)22/h3-8,24H,9H2,1-2H3/b23-8- |
| InChIKey | FVXXSMQGSWXBIX-NYAPKIOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|