C15H14F3N5O4 — CID 3973040
N-[[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]methylideneamino]-2,4-dinitroaniline (PubChem CID 3973040) has the molecular formula C15H14F3N5O4 and a molecular weight of 385.30 g/mol. Its IUPAC name is N-[[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 3973040 |
| Molecular Formula | C15H14F3N5O4 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-[[2,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrrol-3-yl]methylideneamino]-2,4-dinitroaniline |
| SMILES | Cc1cc(C=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(C)n1CC(F)(F)F |
| InChI | InChI=1S/C15H14F3N5O4/c1-9-5-11(10(2)21(9)8-15(16,17)18)7-19-20-13-4-3-12(22(24)25)6-14(13)23(26)27/h3-7,20H,8H2,1-2H3 |
| InChIKey | YKVZRTORKWTIFZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|