C21H21N5O5 — CID 6301279
N-[(Z)-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2,4-dinitroaniline (PubChem CID 6301279) has the molecular formula C21H21N5O5 and a molecular weight of 423.43 g/mol. Its IUPAC name is N-[(Z)-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 6301279 |
| Molecular Formula | C21H21N5O5 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-[(Z)-[1-(4-ethoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2,4-dinitroaniline |
| SMILES | CCOc1ccc(-n2c(C)cc(/C=N\Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C21H21N5O5/c1-4-31-19-8-5-17(6-9-19)24-14(2)11-16(15(24)3)13-22-23-20-10-7-18(25(27)28)12-21(20)26(29)30/h5-13,23H,4H2,1-3H3/b22-13- |
| InChIKey | MRRIFFWPSOWTMS-XKZIYDEJSA-N |
| XLogP | 4.76 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|