C23H21F3N4O4 — CID 126078666
ethyl 3-[2,5-dimethyl-3-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]pyrrol-1-yl]benzoate (PubChem CID 126078666) has the molecular formula C23H21F3N4O4 and a molecular weight of 474.44 g/mol. Its IUPAC name is ethyl 3-[2,5-dimethyl-3-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]pyrrol-1-yl]benzoate.
| Compound Name | ethyl 3-[2,5-dimethyl-3-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 126078666 |
| Molecular Formula | C23H21F3N4O4 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | ethyl 3-[2,5-dimethyl-3-[(Z)-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]methyl]pyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-n2c(C)cc(/C=N\Nc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c2C)c1 |
| InChI | InChI=1S/C23H21F3N4O4/c1-4-34-22(31)16-6-5-7-19(11-16)29-14(2)10-17(15(29)3)13-27-28-20-9-8-18(23(24,25)26)12-21(20)30(32)33/h5-13,28H,4H2,1-3H3/b27-13- |
| InChIKey | BOYAPDMHIVKAIM-WKIKZPBSSA-N |
| XLogP | 5.64 |
| TPSA | 98.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|