C22H21N3O4 — CID 94845552
ethyl 3-[[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]methylideneamino]benzoate (PubChem CID 94845552) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is ethyl 3-[[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]methylideneamino]benzoate.
| Compound Name | ethyl 3-[[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 94845552 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | ethyl 3-[[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]methylideneamino]benzoate |
| SMILES | CCOC(=O)c1cccc(/N=C/c2cc(C)n(-c3cccc([N+](=O)[O-])c3)c2C)c1 |
| InChI | InChI=1S/C22H21N3O4/c1-4-29-22(26)17-7-5-8-19(12-17)23-14-18-11-15(2)24(16(18)3)20-9-6-10-21(13-20)25(27)28/h5-14H,4H2,1-3H3/b23-14+ |
| InChIKey | ZPCPQPRXPIKYLZ-OEAKJJBVSA-N |
| XLogP | 4.93 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|