C23H21N2O5- — CID 54715391
2-carboxy-4-[[1-(4-ethoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]phenolate (PubChem CID 54715391) has the molecular formula C23H21N2O5- and a molecular weight of 405.43 g/mol. Its IUPAC name is 2-carboxy-4-[[1-(4-ethoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]phenolate.
| Compound Name | 2-carboxy-4-[[1-(4-ethoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]phenolate |
|---|---|
| PubChem CID | 54715391 |
| Molecular Formula | C23H21N2O5- |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-carboxy-4-[[1-(4-ethoxycarbonylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]phenolate |
| SMILES | CCOC(=O)c1ccc(-n2c(C)cc(/C=N/c3ccc([O-])c(C(=O)O)c3)c2C)cc1 |
| InChI | InChI=1S/C23H22N2O5/c1-4-30-23(29)16-5-8-19(9-6-16)25-14(2)11-17(15(25)3)13-24-18-7-10-21(26)20(12-18)22(27)28/h5-13,26H,4H2,1-3H3,(H,27,28)/p-1/b24-13+ |
| InChIKey | HHQZGBUYMQHQTH-ZMOGYAJESA-M |
| XLogP | 3.79 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|