C22H22N2O2 — CID 94845447
4-[[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzoic acid (PubChem CID 94845447) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-[[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzoic acid.
| Compound Name | 4-[[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 94845447 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 4-[[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzoic acid |
| SMILES | Cc1cc(C)cc(-n2c(C)cc(/C=N/c3ccc(C(=O)O)cc3)c2C)c1 |
| InChI | InChI=1S/C22H22N2O2/c1-14-9-15(2)11-21(10-14)24-16(3)12-19(17(24)4)13-23-20-7-5-18(6-8-20)22(25)26/h5-13H,1-4H3,(H,25,26)/b23-13+ |
| InChIKey | DZNGGIZLJGBEPO-YDZHTSKRSA-N |
| XLogP | 5.16 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|