C20H20N2O — CID 1275213
4-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]phenol (PubChem CID 1275213) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]phenol.
| Compound Name | 4-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]phenol |
|---|---|
| PubChem CID | 1275213 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methylideneamino]phenol |
| SMILES | Cc1ccc(-n2c(C)cc(/C=N/c3ccc(O)cc3)c2C)cc1 |
| InChI | InChI=1S/C20H20N2O/c1-14-4-8-19(9-5-14)22-15(2)12-17(16(22)3)13-21-18-6-10-20(23)11-7-18/h4-13,23H,1-3H3/b21-13+ |
| InChIKey | UAJHYUYWAUWAEB-FYJGNVAPSA-N |
| XLogP | 4.86 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|