C23H26N2 — CID 94845458
1-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-ethylphenyl)methanimine (PubChem CID 94845458) has the molecular formula C23H26N2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 1-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-ethylphenyl)methanimine.
| Compound Name | 1-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-ethylphenyl)methanimine |
|---|---|
| PubChem CID | 94845458 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-ethylphenyl)methanimine |
| SMILES | CCc1ccc(/N=C/c2cc(C)n(-c3cc(C)cc(C)c3)c2C)cc1 |
| InChI | InChI=1S/C23H26N2/c1-6-20-7-9-22(10-8-20)24-15-21-14-18(4)25(19(21)5)23-12-16(2)11-17(3)13-23/h7-15H,6H2,1-5H3/b24-15+ |
| InChIKey | XRXSTDQNSZJGTD-BUVRLJJBSA-N |
| XLogP | 6.02 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|