C18H18F7N3 — CID 126037561
N-[(E)-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126037561) has the molecular formula C18H18F7N3 and a molecular weight of 409.35 g/mol. Its IUPAC name is N-[(E)-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(E)-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126037561 |
| Molecular Formula | C18H18F7N3 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[(E)-[1-(4-ethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | CCc1ccc(-n2c(C)cc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)c2C)cc1 |
| InChI | InChI=1S/C18H18F7N3/c1-4-13-5-7-15(8-6-13)28-11(2)9-14(12(28)3)10-26-27-18(24,25)16(19,20)17(21,22)23/h5-10,27H,4H2,1-3H3/b26-10+ |
| InChIKey | IXIHPYXNMUFJKM-NSKAYECMSA-N |
| XLogP | 5.37 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|