C25H23F7N4OS — CID 126043639
2-[3-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-2,5-dimethylpyrrol-1-yl]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126043639) has the molecular formula C25H23F7N4OS and a molecular weight of 560.54 g/mol. Its IUPAC name is 2-[3-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-2,5-dimethylpyrrol-1-yl]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[3-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-2,5-dimethylpyrrol-1-yl]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126043639 |
| Molecular Formula | C25H23F7N4OS |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 2-[3-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-2,5-dimethylpyrrol-1-yl]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1cc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)c(C)n1-c1sc2c(c1C(=O)Nc1ccccc1)CCCC2 |
| InChI | InChI=1S/C25H23F7N4OS/c1-14-12-16(13-33-35-25(31,32)23(26,27)24(28,29)30)15(2)36(14)22-20(18-10-6-7-11-19(18)38-22)21(37)34-17-8-4-3-5-9-17/h3-5,8-9,12-13,35H,6-7,10-11H2,1-2H3,(H,34,37)/b33-13+ |
| InChIKey | SOSUOSOLTRNYLV-IIHBXENTSA-N |
| XLogP | 7.00 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|