C32H33N3O4S — CID 5344623
ethyl 2-[3-[(E)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 5344623) has the molecular formula C32H33N3O4S and a molecular weight of 555.70 g/mol. Its IUPAC name is ethyl 2-[3-[(E)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-[(E)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 5344623 |
| Molecular Formula | C32H33N3O4S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | ethyl 2-[3-[(E)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-n2c(C)cc(/C=N/NC(=O)C(O)(c3ccccc3)c3ccccc3)c2C)sc2c1CCCC2 |
| InChI | InChI=1S/C32H33N3O4S/c1-4-39-30(36)28-26-17-11-12-18-27(26)40-29(28)35-21(2)19-23(22(35)3)20-33-34-31(37)32(38,24-13-7-5-8-14-24)25-15-9-6-10-16-25/h5-10,13-16,19-20,38H,4,11-12,17-18H2,1-3H3,(H,34,37)/b33-20+ |
| InChIKey | UFXRSNSRYOWSMR-FMFFXOCNSA-N |
| XLogP | 5.60 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|