C23H24N4O3S — CID 3961758
2-[2,5-dimethyl-3-[(phenylcarbamoylhydrazinylidene)methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (PubChem CID 3961758) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is 2-[2,5-dimethyl-3-[(phenylcarbamoylhydrazinylidene)methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid.
| Compound Name | 2-[2,5-dimethyl-3-[(phenylcarbamoylhydrazinylidene)methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 3961758 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 2-[2,5-dimethyl-3-[(phenylcarbamoylhydrazinylidene)methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
| SMILES | Cc1cc(C=NNC(=O)Nc2ccccc2)c(C)n1-c1sc2c(c1C(=O)O)CCCC2 |
| InChI | InChI=1S/C23H24N4O3S/c1-14-12-16(13-24-26-23(30)25-17-8-4-3-5-9-17)15(2)27(14)21-20(22(28)29)18-10-6-7-11-19(18)31-21/h3-5,8-9,12-13H,6-7,10-11H2,1-2H3,(H,28,29)(H2,25,26,30) |
| InChIKey | MNGDRPSGSQUPHD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|