C28H26ClN5O2S — CID 3300926
2-chloro-N-[[2,5-dimethyl-1-[3-(phenylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyrrol-3-yl]methylideneamino]pyridine-3-carboxamide (PubChem CID 3300926) has the molecular formula C28H26ClN5O2S and a molecular weight of 532.07 g/mol. Its IUPAC name is 2-chloro-N-[[2,5-dimethyl-1-[3-(phenylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyrrol-3-yl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[[2,5-dimethyl-1-[3-(phenylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyrrol-3-yl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3300926 |
| Molecular Formula | C28H26ClN5O2S |
| Molecular Weight | 532.07 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 2-chloro-N-[[2,5-dimethyl-1-[3-(phenylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyrrol-3-yl]methylideneamino]pyridine-3-carboxamide |
| SMILES | Cc1cc(C=NNC(=O)c2cccnc2Cl)c(C)n1-c1sc2c(c1C(=O)Nc1ccccc1)CCCC2 |
| InChI | InChI=1S/C28H26ClN5O2S/c1-17-15-19(16-31-33-26(35)22-12-8-14-30-25(22)29)18(2)34(17)28-24(21-11-6-7-13-23(21)37-28)27(36)32-20-9-4-3-5-10-20/h3-5,8-10,12,14-16H,6-7,11,13H2,1-2H3,(H,32,36)(H,33,35) |
| InChIKey | OHSSXCOLDPGEOL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.07 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|