C30H28Cl2N4O2S — CID 124533988
2-[3-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 124533988) has the molecular formula C30H28Cl2N4O2S and a molecular weight of 579.55 g/mol. Its IUPAC name is 2-[3-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[3-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 124533988 |
| Molecular Formula | C30H28Cl2N4O2S |
| Molecular Weight | 579.55 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | 2-[3-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(-n3c(C)cc(/C=N\NC(=O)c4ccc(Cl)c(Cl)c4)c3C)sc3c2CCCC3)cc1 |
| InChI | InChI=1S/C30H28Cl2N4O2S/c1-17-8-11-22(12-9-17)34-29(38)27-23-6-4-5-7-26(23)39-30(27)36-18(2)14-21(19(36)3)16-33-35-28(37)20-10-13-24(31)25(32)15-20/h8-16H,4-7H2,1-3H3,(H,34,38)(H,35,37)/b33-16- |
| InChIKey | HJPLDKIPIIVLOH-BJUCDSOZSA-N |
| XLogP | 7.67 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.55 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|