C33H31ClN4O2S2 — CID 137025050
2-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 137025050) has the molecular formula C33H31ClN4O2S2 and a molecular weight of 615.22 g/mol. Its IUPAC name is 2-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 137025050 |
| Molecular Formula | C33H31ClN4O2S2 |
| Molecular Weight | 615.22 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | 2-[3-[(Z)-[2-(3-chloro-2-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(-n3c(C)cc(/C=C4\S/C(=N/c5cccc(Cl)c5C)NC4=O)c3C)sc3c2CCCC3)cc1 |
| InChI | InChI=1S/C33H31ClN4O2S2/c1-18-12-14-23(15-13-18)35-31(40)29-24-8-5-6-11-27(24)41-32(29)38-19(2)16-22(21(38)4)17-28-30(39)37-33(42-28)36-26-10-7-9-25(34)20(26)3/h7,9-10,12-17H,5-6,8,11H2,1-4H3,(H,35,40)(H,36,37,39)/b28-17- |
| InChIKey | GUZCINTUIUIUQM-QRQIAZFYSA-N |
| XLogP | 8.45 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.22 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|