C26H24FN3O3S2 — CID 137107634
methyl 2-[3-[(Z)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 137107634) has the molecular formula C26H24FN3O3S2 and a molecular weight of 509.63 g/mol. Its IUPAC name is methyl 2-[3-[(Z)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[3-[(Z)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137107634 |
| Molecular Formula | C26H24FN3O3S2 |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | methyl 2-[3-[(Z)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-n2c(C)cc(/C=C3\S/C(=N/c4ccc(F)cc4)NC3=O)c2C)sc2c1CCCC2 |
| InChI | InChI=1S/C26H24FN3O3S2/c1-14-12-16(13-21-23(31)29-26(35-21)28-18-10-8-17(27)9-11-18)15(2)30(14)24-22(25(32)33-3)19-6-4-5-7-20(19)34-24/h8-13H,4-7H2,1-3H3,(H,28,29,31)/b21-13- |
| InChIKey | JKYUKSWMCAFEQD-BKUYFWCQSA-N |
| XLogP | 5.85 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|