C27H27N3O3S2 — CID 137155914
2-[3-[(Z)-[2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (PubChem CID 137155914) has the molecular formula C27H27N3O3S2 and a molecular weight of 505.67 g/mol. Its IUPAC name is 2-[3-[(Z)-[2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid.
| Compound Name | 2-[3-[(Z)-[2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 137155914 |
| Molecular Formula | C27H27N3O3S2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 2-[3-[(Z)-[2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
| SMILES | Cc1cc(C)cc(/N=C2\NC(=O)/C(=C/c3cc(C)n(-c4sc5c(c4C(=O)O)CCCC5)c3C)S2)c1 |
| InChI | InChI=1S/C27H27N3O3S2/c1-14-9-15(2)11-19(10-14)28-27-29-24(31)22(35-27)13-18-12-16(3)30(17(18)4)25-23(26(32)33)20-7-5-6-8-21(20)34-25/h9-13H,5-8H2,1-4H3,(H,32,33)(H,28,29,31)/b22-13- |
| InChIKey | PTIOSGOBRYOSDH-XKZIYDEJSA-N |
| XLogP | 6.24 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|