C32H30N4O2S2 — CID 137173978
2-[2,5-dimethyl-3-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 137173978) has the molecular formula C32H30N4O2S2 and a molecular weight of 566.75 g/mol. Its IUPAC name is 2-[2,5-dimethyl-3-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[2,5-dimethyl-3-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 137173978 |
| Molecular Formula | C32H30N4O2S2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 2-[2,5-dimethyl-3-[(Z)-(4-oxo-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(-n3c(C)cc(/C=C4\S/C(=N/c5ccccc5)NC4=O)c3C)sc3c2CCCC3)cc1 |
| InChI | InChI=1S/C32H30N4O2S2/c1-19-13-15-24(16-14-19)33-30(38)28-25-11-7-8-12-26(25)39-31(28)36-20(2)17-22(21(36)3)18-27-29(37)35-32(40-27)34-23-9-5-4-6-10-23/h4-6,9-10,13-18H,7-8,11-12H2,1-3H3,(H,33,38)(H,34,35,37)/b27-18- |
| InChIKey | MUKXXUQKNLNERA-IMRQLAEWSA-N |
| XLogP | 7.49 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|