C30H31N3O5S2 — CID 126097927
propan-2-yl 2-[(5E)-5-[[2,5-dimethyl-1-[3-(phenylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126097927) has the molecular formula C30H31N3O5S2 and a molecular weight of 577.73 g/mol. Its IUPAC name is propan-2-yl 2-[(5E)-5-[[2,5-dimethyl-1-[3-(phenylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(5E)-5-[[2,5-dimethyl-1-[3-(phenylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126097927 |
| Molecular Formula | C30H31N3O5S2 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | propan-2-yl 2-[(5E)-5-[[2,5-dimethyl-1-[3-(phenylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyrrol-3-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | Cc1cc(/C=C2/SC(=O)N(CC(=O)OC(C)C)C2=O)c(C)n1-c1sc2c(c1C(=O)Nc1ccccc1)CCCC2 |
| InChI | InChI=1S/C30H31N3O5S2/c1-17(2)38-25(34)16-32-28(36)24(40-30(32)37)15-20-14-18(3)33(19(20)4)29-26(22-12-8-9-13-23(22)39-29)27(35)31-21-10-6-5-7-11-21/h5-7,10-11,14-15,17H,8-9,12-13,16H2,1-4H3,(H,31,35)/b24-15+ |
| InChIKey | VHOABFKUABSNLL-BUVRLJJBSA-N |
| XLogP | 6.27 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|