C22H22N2O4S2 — CID 3944294
2-[3-[(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (PubChem CID 3944294) has the molecular formula C22H22N2O4S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[3-[(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid.
| Compound Name | 2-[3-[(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 3944294 |
| Molecular Formula | C22H22N2O4S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 2-[3-[(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
| SMILES | C=CCN1C(=O)SC(=Cc2cc(C)n(-c3sc4c(c3C(=O)O)CCCC4)c2C)C1=O |
| InChI | InChI=1S/C22H22N2O4S2/c1-4-9-23-19(25)17(30-22(23)28)11-14-10-12(2)24(13(14)3)20-18(21(26)27)15-7-5-6-8-16(15)29-20/h4,10-11H,1,5-9H2,2-3H3,(H,26,27) |
| InChIKey | MPZTUJZDRCBNRX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|