C22H24N2O4S2 — CID 6043896
ethyl 2-[2,5-dimethyl-3-[(Z)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 6043896) has the molecular formula C22H24N2O4S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is ethyl 2-[2,5-dimethyl-3-[(Z)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[2,5-dimethyl-3-[(Z)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 6043896 |
| Molecular Formula | C22H24N2O4S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | ethyl 2-[2,5-dimethyl-3-[(Z)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-n2c(C)cc(/C=C3\SC(=O)N(C)C3=O)c2C)sc2c1CCCC2 |
| InChI | InChI=1S/C22H24N2O4S2/c1-5-28-21(26)18-15-8-6-7-9-16(15)29-20(18)24-12(2)10-14(13(24)3)11-17-19(25)23(4)22(27)30-17/h10-11H,5-9H2,1-4H3/b17-11- |
| InChIKey | JYRPKUOKDDRUKV-BOPFTXTBSA-N |
| XLogP | 4.88 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|