C29H31N3O4S2 — CID 137162705
ethyl 2-[3-[(Z)-[2-(2-methoxy-5-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 137162705) has the molecular formula C29H31N3O4S2 and a molecular weight of 549.72 g/mol. Its IUPAC name is ethyl 2-[3-[(Z)-[2-(2-methoxy-5-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-[(Z)-[2-(2-methoxy-5-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137162705 |
| Molecular Formula | C29H31N3O4S2 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | ethyl 2-[3-[(Z)-[2-(2-methoxy-5-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-n2c(C)cc(/C=C3\S/C(=N/c4cc(C)ccc4OC)NC3=O)c2C)sc2c1CCCC2 |
| InChI | InChI=1S/C29H31N3O4S2/c1-6-36-28(34)25-20-9-7-8-10-23(20)37-27(25)32-17(3)14-19(18(32)4)15-24-26(33)31-29(38-24)30-21-13-16(2)11-12-22(21)35-5/h11-15H,6-10H2,1-5H3,(H,30,31,33)/b24-15- |
| InChIKey | MUURZRCASVTKSI-IWIPYMOSSA-N |
| XLogP | 6.42 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|