C26H30N2O6S2 — CID 126026982
ethyl 2-[3-[(E)-[3-[(2R)-1-ethoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 126026982) has the molecular formula C26H30N2O6S2 and a molecular weight of 530.67 g/mol. Its IUPAC name is ethyl 2-[3-[(E)-[3-[(2R)-1-ethoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-[(E)-[3-[(2R)-1-ethoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 126026982 |
| Molecular Formula | C26H30N2O6S2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | ethyl 2-[3-[(E)-[3-[(2R)-1-ethoxy-1-oxopropan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-n2c(C)cc(/C=C3/SC(=O)N([C@H](C)C(=O)OCC)C3=O)c2C)sc2c1CCCC2 |
| InChI | InChI=1S/C26H30N2O6S2/c1-6-33-24(30)16(5)28-22(29)20(36-26(28)32)13-17-12-14(3)27(15(17)4)23-21(25(31)34-7-2)18-10-8-9-11-19(18)35-23/h12-13,16H,6-11H2,1-5H3/b20-13+/t16-/m1/s1 |
| InChIKey | OWCWWFGFPPXCOZ-RBYWHNRPSA-N |
| XLogP | 5.20 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|