C26H23ClN4O2S2 — CID 137162204
2-[3-[(Z)-[2-(5-chloro-2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 137162204) has the molecular formula C26H23ClN4O2S2 and a molecular weight of 523.08 g/mol. Its IUPAC name is 2-[3-[(Z)-[2-(5-chloro-2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-[3-[(Z)-[2-(5-chloro-2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 137162204 |
| Molecular Formula | C26H23ClN4O2S2 |
| Molecular Weight | 523.08 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 2-[3-[(Z)-[2-(5-chloro-2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | COc1ccc(Cl)cc1/N=C1\NC(=O)/C(=C/c2cc(C)n(-c3sc4c(c3C#N)CCCC4)c2C)S1 |
| InChI | InChI=1S/C26H23ClN4O2S2/c1-14-10-16(15(2)31(14)25-19(13-28)18-6-4-5-7-22(18)34-25)11-23-24(32)30-26(35-23)29-20-12-17(27)8-9-21(20)33-3/h8-12H,4-7H2,1-3H3,(H,29,30,32)/b23-11- |
| InChIKey | HSFGTGNZVHREPI-KSEXSDGBSA-N |
| XLogP | 6.46 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.08 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|