C31H28N4O3S2 — CID 126389539
2-[2,5-dimethyl-3-[(Z)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (PubChem CID 126389539) has the molecular formula C31H28N4O3S2 and a molecular weight of 568.72 g/mol. Its IUPAC name is 2-[2,5-dimethyl-3-[(Z)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid.
| Compound Name | 2-[2,5-dimethyl-3-[(Z)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 126389539 |
| Molecular Formula | C31H28N4O3S2 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 2-[2,5-dimethyl-3-[(Z)-[4-oxo-2-phenylimino-3-(pyridin-3-ylmethyl)-1,3-thiazolidin-5-ylidene]methyl]pyrrol-1-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
| SMILES | Cc1cc(/C=C2\S/C(=N\c3ccccc3)N(Cc3cccnc3)C2=O)c(C)n1-c1sc2c(c1C(=O)O)CCCC2 |
| InChI | InChI=1S/C31H28N4O3S2/c1-19-15-22(20(2)35(19)29-27(30(37)38)24-12-6-7-13-25(24)39-29)16-26-28(36)34(18-21-9-8-14-32-17-21)31(40-26)33-23-10-4-3-5-11-23/h3-5,8-11,14-17H,6-7,12-13,18H2,1-2H3,(H,37,38)/b26-16-,33-31- |
| InChIKey | HVTLXFVWWRRKCU-CBOIFWCFSA-N |
| XLogP | 6.93 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|