C32H36N4OS — CID 50862731
(5E)-2-phenylimino-3-(pyridin-3-ylmethyl)-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 50862731) has the molecular formula C32H36N4OS and a molecular weight of 524.73 g/mol. Its IUPAC name is (5E)-2-phenylimino-3-(pyridin-3-ylmethyl)-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-phenylimino-3-(pyridin-3-ylmethyl)-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50862731 |
| Molecular Formula | C32H36N4OS |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | (5E)-2-phenylimino-3-(pyridin-3-ylmethyl)-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCN1c2cc(C)c(/C=C3/S/C(=N\c4ccccc4)N(Cc4cccnc4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C32H36N4OS/c1-6-15-36-28-16-22(2)25(17-27(28)23(3)19-32(36,4)5)18-29-30(37)35(21-24-11-10-14-33-20-24)31(38-29)34-26-12-8-7-9-13-26/h7-14,16-18,20,23H,6,15,19,21H2,1-5H3/b29-18+,34-31- |
| InChIKey | GJOPKOKRHZBKCL-OGYQRLPCSA-N |
| XLogP | 7.70 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|