C32H35N3OS — CID 50862506
(5E)-3-phenyl-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 50862506) has the molecular formula C32H35N3OS and a molecular weight of 509.72 g/mol. Its IUPAC name is (5E)-3-phenyl-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-phenyl-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50862506 |
| Molecular Formula | C32H35N3OS |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | (5E)-3-phenyl-2-phenylimino-5-[(2,2,4,7-tetramethyl-1-propyl-3,4-dihydroquinolin-6-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCN1c2cc(C)c(/C=C3/S/C(=N\c4ccccc4)N(c4ccccc4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C32H35N3OS/c1-6-17-34-28-18-22(2)24(19-27(28)23(3)21-32(34,4)5)20-29-30(36)35(26-15-11-8-12-16-26)31(37-29)33-25-13-9-7-10-14-25/h7-16,18-20,23H,6,17,21H2,1-5H3/b29-20+,33-31- |
| InChIKey | VDGISJFVXPFGKA-PIFONXOTSA-N |
| XLogP | 8.31 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|