C27H33N3OS — CID 132674318
(5Z)-5-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylidene]-2-phenylimino-3-propyl-1,3-thiazolidin-4-one (PubChem CID 132674318) has the molecular formula C27H33N3OS and a molecular weight of 447.65 g/mol. Its IUPAC name is (5Z)-5-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylidene]-2-phenylimino-3-propyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylidene]-2-phenylimino-3-propyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 132674318 |
| Molecular Formula | C27H33N3OS |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | (5Z)-5-[(1,2,2,4,7-pentamethyl-3,4-dihydroquinolin-6-yl)methylidene]-2-phenylimino-3-propyl-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2cc3c(cc2C)N(C)C(C)(C)CC3C)S/C1=N/c1ccccc1 |
| InChI | InChI=1S/C27H33N3OS/c1-7-13-30-25(31)24(32-26(30)28-21-11-9-8-10-12-21)16-20-15-22-19(3)17-27(4,5)29(6)23(22)14-18(20)2/h8-12,14-16,19H,7,13,17H2,1-6H3/b24-16-,28-26+ |
| InChIKey | WWYSEDDAYLITQW-WFFFFOTMSA-N |
| XLogP | 6.73 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|